C10H15IN2O — CID 163875838
4-iodo-N-(1-methoxybutan-2-yl)pyridin-2-amine (PubChem CID 163875838) has the molecular formula C10H15IN2O and a molecular weight of 306.15 g/mol. Its IUPAC name is 4-iodo-N-(1-methoxybutan-2-yl)pyridin-2-amine.
| Compound Name | 4-iodo-N-(1-methoxybutan-2-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 163875838 |
| Molecular Formula | C10H15IN2O |
| Molecular Weight | 306.15 g/mol |
| Exact Mass | 306.02 |
| IUPAC Name | 4-iodo-N-(1-methoxybutan-2-yl)pyridin-2-amine |
| SMILES | CCC(COC)Nc1cc(I)ccn1 |
| InChI | InChI=1S/C10H15IN2O/c1-3-9(7-14-2)13-10-6-8(11)4-5-12-10/h4-6,9H,3,7H2,1-2H3,(H,12,13) |
| InChIKey | POTOGRWEZZOOFG-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.15 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|