C15H18N2O3 — CID 65195255
(3,4-diethoxyphenyl)-(1-methylpyrazol-3-yl)methanone (PubChem CID 65195255) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is (3,4-diethoxyphenyl)-(1-methylpyrazol-3-yl)methanone.
| Compound Name | (3,4-diethoxyphenyl)-(1-methylpyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 65195255 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | (3,4-diethoxyphenyl)-(1-methylpyrazol-3-yl)methanone |
| SMILES | CCOc1ccc(C(=O)c2ccn(C)n2)cc1OCC |
| InChI | InChI=1S/C15H18N2O3/c1-4-19-13-7-6-11(10-14(13)20-5-2)15(18)12-8-9-17(3)16-12/h6-10H,4-5H2,1-3H3 |
| InChIKey | XNNZGNJZUFGYGW-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |