C15H29N — CID 65196171
N-[[1-(cyclopentylmethyl)cyclobutyl]methyl]-2-methylpropan-1-amine (PubChem CID 65196171) has the molecular formula C15H29N and a molecular weight of 223.40 g/mol. Its IUPAC name is N-[[1-(cyclopentylmethyl)cyclobutyl]methyl]-2-methylpropan-1-amine.
| Compound Name | N-[[1-(cyclopentylmethyl)cyclobutyl]methyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 65196171 |
| Molecular Formula | C15H29N |
| Molecular Weight | 223.40 g/mol |
| Exact Mass | 223.23 |
| IUPAC Name | N-[[1-(cyclopentylmethyl)cyclobutyl]methyl]-2-methylpropan-1-amine |
| SMILES | CC(C)CNCC1(CC2CCCC2)CCC1 |
| InChI | InChI=1S/C15H29N/c1-13(2)11-16-12-15(8-5-9-15)10-14-6-3-4-7-14/h13-14,16H,3-12H2,1-2H3 |
| InChIKey | NWRIZJSIYAITKB-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.40 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |