C18H33N — CID 79562303
N-[[1-(2-bicyclo[2.2.1]heptanylmethyl)cyclopentyl]methyl]-2-methylpropan-1-amine (PubChem CID 79562303) has the molecular formula C18H33N and a molecular weight of 263.47 g/mol. Its IUPAC name is N-[[1-(2-bicyclo[2.2.1]heptanylmethyl)cyclopentyl]methyl]-2-methylpropan-1-amine.
| Compound Name | N-[[1-(2-bicyclo[2.2.1]heptanylmethyl)cyclopentyl]methyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 79562303 |
| Molecular Formula | C18H33N |
| Molecular Weight | 263.47 g/mol |
| Exact Mass | 263.26 |
| IUPAC Name | N-[[1-(2-bicyclo[2.2.1]heptanylmethyl)cyclopentyl]methyl]-2-methylpropan-1-amine |
| SMILES | CC(C)CNCC1(CC2CC3CCC2C3)CCCC1 |
| InChI | InChI=1S/C18H33N/c1-14(2)12-19-13-18(7-3-4-8-18)11-17-10-15-5-6-16(17)9-15/h14-17,19H,3-13H2,1-2H3 |
| InChIKey | BUVGHKARXZQDRK-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.47 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |