C10H14N6O2 — CID 65196844
1-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-4-nitropyrazol-5-amine (PubChem CID 65196844) has the molecular formula C10H14N6O2 and a molecular weight of 250.26 g/mol. Its IUPAC name is 1-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-4-nitropyrazol-5-amine.
| Compound Name | 1-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-4-nitropyrazol-5-amine |
|---|---|
| PubChem CID | 65196844 |
| Molecular Formula | C10H14N6O2 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 1-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-4-nitropyrazol-5-amine |
| SMILES | Cc1nn(C)cc1C(C)n1ncc([N+](=O)[O-])c1N |
| InChI | InChI=1S/C10H14N6O2/c1-6-8(5-14(3)13-6)7(2)15-10(11)9(4-12-15)16(17)18/h4-5,7H,11H2,1-3H3 |
| InChIKey | BUBJFTQNZWZVOJ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 104.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|