C12H18N6O2 — CID 22196621
N-methyl-N-[(4-nitropyrazol-1-yl)methyl]-1-(1,3,5-trimethylpyrazol-4-yl)methanamine (PubChem CID 22196621) has the molecular formula C12H18N6O2 and a molecular weight of 278.32 g/mol. Its IUPAC name is N-methyl-N-[(4-nitropyrazol-1-yl)methyl]-1-(1,3,5-trimethylpyrazol-4-yl)methanamine.
| Compound Name | N-methyl-N-[(4-nitropyrazol-1-yl)methyl]-1-(1,3,5-trimethylpyrazol-4-yl)methanamine |
|---|---|
| PubChem CID | 22196621 |
| Molecular Formula | C12H18N6O2 |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | N-methyl-N-[(4-nitropyrazol-1-yl)methyl]-1-(1,3,5-trimethylpyrazol-4-yl)methanamine |
| SMILES | Cc1nn(C)c(C)c1CN(C)Cn1cc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C12H18N6O2/c1-9-12(10(2)16(4)14-9)7-15(3)8-17-6-11(5-13-17)18(19)20/h5-6H,7-8H2,1-4H3 |
| InChIKey | WQBYSMRCVRGHEA-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 82.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|