C29H32N4O5S — CID 6520446
[2-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)-2-oxoethyl] (E)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enoate (PubChem CID 6520446) has the molecular formula C29H32N4O5S and a molecular weight of 548.67 g/mol. Its IUPAC name is [2-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)-2-oxoethyl] (E)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enoate.
| Compound Name | [2-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)-2-oxoethyl] (E)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enoate |
|---|---|
| PubChem CID | 6520446 |
| Molecular Formula | C29H32N4O5S |
| Molecular Weight | 548.67 g/mol |
| Exact Mass | 548.21 |
| IUPAC Name | [2-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)-2-oxoethyl] (E)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enoate |
| SMILES | CCCn1c(C)cc(/C=C(\C#N)C(=O)OCC(=O)N2CCN(S(=O)(=O)c3ccc4ccccc4c3)CC2)c1C |
| InChI | InChI=1S/C29H32N4O5S/c1-4-11-33-21(2)16-25(22(33)3)17-26(19-30)29(35)38-20-28(34)31-12-14-32(15-13-31)39(36,37)27-10-9-23-7-5-6-8-24(23)18-27/h5-10,16-18H,4,11-15,20H2,1-3H3/b26-17+ |
| InChIKey | CVGJWONHDMULGY-YZSQISJMSA-N |
| XLogP | 3.65 |
| TPSA | 112.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.67 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|