C13H14N4OS2 — CID 65204613
N-(3-carbamothioylphenyl)-4-propan-2-ylthiadiazole-5-carboxamide (PubChem CID 65204613) has the molecular formula C13H14N4OS2 and a molecular weight of 306.42 g/mol. Its IUPAC name is N-(3-carbamothioylphenyl)-4-propan-2-ylthiadiazole-5-carboxamide.
| Compound Name | N-(3-carbamothioylphenyl)-4-propan-2-ylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 65204613 |
| Molecular Formula | C13H14N4OS2 |
| Molecular Weight | 306.42 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | N-(3-carbamothioylphenyl)-4-propan-2-ylthiadiazole-5-carboxamide |
| SMILES | CC(C)c1nnsc1C(=O)Nc1cccc(C(N)=S)c1 |
| InChI | InChI=1S/C13H14N4OS2/c1-7(2)10-11(20-17-16-10)13(18)15-9-5-3-4-8(6-9)12(14)19/h3-7H,1-2H3,(H2,14,19)(H,15,18) |
| InChIKey | CJDYNEYDZAIYCU-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.42 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|