C12H18N4OS2 — CID 65205177
1-(4-propylthiadiazole-5-carbonyl)piperidine-3-carbothioamide (PubChem CID 65205177) has the molecular formula C12H18N4OS2 and a molecular weight of 298.44 g/mol. Its IUPAC name is 1-(4-propylthiadiazole-5-carbonyl)piperidine-3-carbothioamide.
| Compound Name | 1-(4-propylthiadiazole-5-carbonyl)piperidine-3-carbothioamide |
|---|---|
| PubChem CID | 65205177 |
| Molecular Formula | C12H18N4OS2 |
| Molecular Weight | 298.44 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 1-(4-propylthiadiazole-5-carbonyl)piperidine-3-carbothioamide |
| SMILES | CCCc1nnsc1C(=O)N1CCCC(C(N)=S)C1 |
| InChI | InChI=1S/C12H18N4OS2/c1-2-4-9-10(19-15-14-9)12(17)16-6-3-5-8(7-16)11(13)18/h8H,2-7H2,1H3,(H2,13,18) |
| InChIKey | VSCZFLJQSXCKJC-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.44 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|