C11H18N4OS — CID 65210383
(3-aminopiperidin-1-yl)-(4-propylthiadiazol-5-yl)methanone (PubChem CID 65210383) has the molecular formula C11H18N4OS and a molecular weight of 254.36 g/mol. Its IUPAC name is (3-aminopiperidin-1-yl)-(4-propylthiadiazol-5-yl)methanone.
| Compound Name | (3-aminopiperidin-1-yl)-(4-propylthiadiazol-5-yl)methanone |
|---|---|
| PubChem CID | 65210383 |
| Molecular Formula | C11H18N4OS |
| Molecular Weight | 254.36 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | (3-aminopiperidin-1-yl)-(4-propylthiadiazol-5-yl)methanone |
| SMILES | CCCc1nnsc1C(=O)N1CCCC(N)C1 |
| InChI | InChI=1S/C11H18N4OS/c1-2-4-9-10(17-14-13-9)11(16)15-6-3-5-8(12)7-15/h8H,2-7,12H2,1H3 |
| InChIKey | RPLQQHYGJQLWAO-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.36 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |