C19H24N2O4S — CID 652055
1-(benzenesulfonyl)-4-[(2,4-dimethoxyphenyl)methyl]piperazine (PubChem CID 652055) has the molecular formula C19H24N2O4S and a molecular weight of 376.48 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-4-[(2,4-dimethoxyphenyl)methyl]piperazine.
| Compound Name | 1-(benzenesulfonyl)-4-[(2,4-dimethoxyphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 652055 |
| Molecular Formula | C19H24N2O4S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 1-(benzenesulfonyl)-4-[(2,4-dimethoxyphenyl)methyl]piperazine |
| SMILES | COc1ccc(CN2CCN(S(=O)(=O)c3ccccc3)CC2)c(OC)c1 |
| InChI | InChI=1S/C19H24N2O4S/c1-24-17-9-8-16(19(14-17)25-2)15-20-10-12-21(13-11-20)26(22,23)18-6-4-3-5-7-18/h3-9,14H,10-13,15H2,1-2H3 |
| InChIKey | CAXSNKMSODPZEI-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |