C21H26N2O8S — CID 652054
1-(benzenesulfonyl)-4-[(2,4-dimethoxyphenyl)methyl]piperazine;oxalic acid (PubChem CID 652054) has the molecular formula C21H26N2O8S and a molecular weight of 466.51 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-4-[(2,4-dimethoxyphenyl)methyl]piperazine;oxalic acid.
| Compound Name | 1-(benzenesulfonyl)-4-[(2,4-dimethoxyphenyl)methyl]piperazine;oxalic acid |
|---|---|
| PubChem CID | 652054 |
| Molecular Formula | C21H26N2O8S |
| Molecular Weight | 466.51 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | 1-(benzenesulfonyl)-4-[(2,4-dimethoxyphenyl)methyl]piperazine;oxalic acid |
| SMILES | COc1ccc(CN2CCN(S(=O)(=O)c3ccccc3)CC2)c(OC)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H24N2O4S.C2H2O4/c1-24-17-9-8-16(19(14-17)25-2)15-20-10-12-21(13-11-20)26(22,23)18-6-4-3-5-7-18;3-1(4)2(5)6/h3-9,14H,10-13,15H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | IDTCMWBCXVAFTG-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 133.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.51 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|