C12H19N3O3S — CID 65206032
3-[tert-butyl-(4-ethylthiadiazole-5-carbonyl)amino]propanoic acid (PubChem CID 65206032) has the molecular formula C12H19N3O3S and a molecular weight of 285.37 g/mol. Its IUPAC name is 3-[tert-butyl-(4-ethylthiadiazole-5-carbonyl)amino]propanoic acid.
| Compound Name | 3-[tert-butyl-(4-ethylthiadiazole-5-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 65206032 |
| Molecular Formula | C12H19N3O3S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 3-[tert-butyl-(4-ethylthiadiazole-5-carbonyl)amino]propanoic acid |
| SMILES | CCc1nnsc1C(=O)N(CCC(=O)O)C(C)(C)C |
| InChI | InChI=1S/C12H19N3O3S/c1-5-8-10(19-14-13-8)11(18)15(12(2,3)4)7-6-9(16)17/h5-7H2,1-4H3,(H,16,17) |
| InChIKey | UIMNVIHNOKXWGK-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |