C5H7N3OS — CID 45084470
4-ethylthiadiazole-5-carboxamide (PubChem CID 45084470) has the molecular formula C5H7N3OS and a molecular weight of 157.20 g/mol. Its IUPAC name is 4-ethylthiadiazole-5-carboxamide.
| Compound Name | 4-ethylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 45084470 |
| Molecular Formula | C5H7N3OS |
| Molecular Weight | 157.20 g/mol |
| Exact Mass | 157.03 |
| IUPAC Name | 4-ethylthiadiazole-5-carboxamide |
| SMILES | CCc1nnsc1C(N)=O |
| InChI | InChI=1S/C5H7N3OS/c1-2-3-4(5(6)9)10-8-7-3/h2H2,1H3,(H2,6,9) |
| InChIKey | YQSBEYPYNVGYLN-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.20 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |