C9H17N3O2S — CID 18667662
tert-butylazanium;4-ethylthiadiazole-5-carboxylate (PubChem CID 18667662) has the molecular formula C9H17N3O2S and a molecular weight of 231.32 g/mol. Its IUPAC name is tert-butylazanium;4-ethylthiadiazole-5-carboxylate.
| Compound Name | tert-butylazanium;4-ethylthiadiazole-5-carboxylate |
|---|---|
| PubChem CID | 18667662 |
| Molecular Formula | C9H17N3O2S |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | tert-butylazanium;4-ethylthiadiazole-5-carboxylate |
| SMILES | CC(C)(C)[NH3+].CCc1nnsc1C(=O)[O-] |
| InChI | InChI=1S/C5H6N2O2S.C4H11N/c1-2-3-4(5(8)9)10-7-6-3;1-4(2,3)5/h2H2,1H3,(H,8,9);5H2,1-3H3 |
| InChIKey | UCRIPANZPSECBG-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |