About tert-butylazanium;4-ethylthiadiazole-5-carboxylate
tert-butylazanium;4-ethylthiadiazole-5-carboxylate (PubChem CID 18667662) has the molecular formula C9H17N3O2S
and a molecular weight of 231.32 g/mol. Its IUPAC name is tert-butylazanium;4-ethylthiadiazole-5-carboxylate.
Molecular Properties
| Compound Name | tert-butylazanium;4-ethylthiadiazole-5-carboxylate |
| PubChem CID | 18667662 |
| Molecular Formula | C9H17N3O2S |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | tert-butylazanium;4-ethylthiadiazole-5-carboxylate |
| SMILES | CC(C)(C)[NH3+].CCc1nnsc1C(=O)[O-] |
| InChI | InChI=1S/C5H6N2O2S.C4H11N/c1-2-3-4(5(8)9)10-7-6-3;1-4(2,3)5/h2H2,1H3,(H,8,9);5H2,1-3H3 |
| InChIKey | UCRIPANZPSECBG-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butylazanium;4-ethylthiadiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butylazanium;4-ethylthiadiazole-5-carboxylate?
The IUPAC name of tert-butylazanium;4-ethylthiadiazole-5-carboxylate (CID 18667662) is tert-butylazanium;4-ethylthiadiazole-5-carboxylate.
What is the SMILES notation for tert-butylazanium;4-ethylthiadiazole-5-carboxylate?
The canonical SMILES for tert-butylazanium;4-ethylthiadiazole-5-carboxylate is CC(C)(C)[NH3+].CCc1nnsc1C(=O)[O-].
What is the InChIKey of tert-butylazanium;4-ethylthiadiazole-5-carboxylate?
The InChIKey is UCRIPANZPSECBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O2S.C4H11N/c1-2-3-4(5(8)9)10-7-6-3;1-4(2,3)5/h2H2,1H3,(H,8,9);5H2,1-3H3.
What are the key properties of tert-butylazanium;4-ethylthiadiazole-5-carboxylate?
tert-butylazanium;4-ethylthiadiazole-5-carboxylate has a molecular weight of 231.32 g/mol, XLogP of -0.51, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butylazanium;4-ethylthiadiazole-5-carboxylate is sourced from PubChem (CID 18667662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).