C10H17N5O2S — CID 104873808
N-(3-amino-3-hydroxyimino-2,2-dimethylpropyl)-4-ethylthiadiazole-5-carboxamide (PubChem CID 104873808) has the molecular formula C10H17N5O2S and a molecular weight of 271.35 g/mol. Its IUPAC name is N-(3-amino-3-hydroxyimino-2,2-dimethylpropyl)-4-ethylthiadiazole-5-carboxamide.
| Compound Name | N-(3-amino-3-hydroxyimino-2,2-dimethylpropyl)-4-ethylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 104873808 |
| Molecular Formula | C10H17N5O2S |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | N-(3-amino-3-hydroxyimino-2,2-dimethylpropyl)-4-ethylthiadiazole-5-carboxamide |
| SMILES | CCc1nnsc1C(=O)NCC(C)(C)C(N)=NO |
| InChI | InChI=1S/C10H17N5O2S/c1-4-6-7(18-15-13-6)8(16)12-5-10(2,3)9(11)14-17/h17H,4-5H2,1-3H3,(H2,11,14)(H,12,16) |
| InChIKey | XFUBYXVOXNUKIE-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 113.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.35 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|