C11H20O3S — CID 65208135
3-[(1-hydroxycyclohexyl)methylsulfanyl]-2-methylpropanoic acid (PubChem CID 65208135) has the molecular formula C11H20O3S and a molecular weight of 232.34 g/mol. Its IUPAC name is 3-[(1-hydroxycyclohexyl)methylsulfanyl]-2-methylpropanoic acid.
| Compound Name | 3-[(1-hydroxycyclohexyl)methylsulfanyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 65208135 |
| Molecular Formula | C11H20O3S |
| Molecular Weight | 232.34 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 3-[(1-hydroxycyclohexyl)methylsulfanyl]-2-methylpropanoic acid |
| SMILES | CC(CSCC1(O)CCCCC1)C(=O)O |
| InChI | InChI=1S/C11H20O3S/c1-9(10(12)13)7-15-8-11(14)5-3-2-4-6-11/h9,14H,2-8H2,1H3,(H,12,13) |
| InChIKey | COCKCFIVOHNQQM-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.34 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |