C6H6N6S2 — CID 65208622
1-(5-methyl-1,3,4-thiadiazol-2-yl)-1,2,4-triazole-3-carbothioamide (PubChem CID 65208622) has the molecular formula C6H6N6S2 and a molecular weight of 226.29 g/mol. Its IUPAC name is 1-(5-methyl-1,3,4-thiadiazol-2-yl)-1,2,4-triazole-3-carbothioamide.
| Compound Name | 1-(5-methyl-1,3,4-thiadiazol-2-yl)-1,2,4-triazole-3-carbothioamide |
|---|---|
| PubChem CID | 65208622 |
| Molecular Formula | C6H6N6S2 |
| Molecular Weight | 226.29 g/mol |
| Exact Mass | 226.01 |
| IUPAC Name | 1-(5-methyl-1,3,4-thiadiazol-2-yl)-1,2,4-triazole-3-carbothioamide |
| SMILES | Cc1nnc(-n2cnc(C(N)=S)n2)s1 |
| InChI | InChI=1S/C6H6N6S2/c1-3-9-10-6(14-3)12-2-8-5(11-12)4(7)13/h2H,1H3,(H2,7,13) |
| InChIKey | AAVXQWQGRXXYQS-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.29 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|