C11H12N4S — CID 65209746
N-[(4-pyridin-2-ylthiadiazol-5-yl)methyl]cyclopropanamine (PubChem CID 65209746) has the molecular formula C11H12N4S and a molecular weight of 232.31 g/mol. Its IUPAC name is N-[(4-pyridin-2-ylthiadiazol-5-yl)methyl]cyclopropanamine.
| Compound Name | N-[(4-pyridin-2-ylthiadiazol-5-yl)methyl]cyclopropanamine |
|---|---|
| PubChem CID | 65209746 |
| Molecular Formula | C11H12N4S |
| Molecular Weight | 232.31 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | N-[(4-pyridin-2-ylthiadiazol-5-yl)methyl]cyclopropanamine |
| SMILES | c1ccc(-c2nnsc2CNC2CC2)nc1 |
| InChI | InChI=1S/C11H12N4S/c1-2-6-12-9(3-1)11-10(16-15-14-11)7-13-8-4-5-8/h1-3,6,8,13H,4-5,7H2 |
| InChIKey | FUEJSVYJCPQHLW-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.31 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |