C13H14N2S — CID 81174282
N-[(4-phenyl-1,3-thiazol-5-yl)methyl]cyclopropanamine (PubChem CID 81174282) has the molecular formula C13H14N2S and a molecular weight of 230.34 g/mol. Its IUPAC name is N-[(4-phenyl-1,3-thiazol-5-yl)methyl]cyclopropanamine.
| Compound Name | N-[(4-phenyl-1,3-thiazol-5-yl)methyl]cyclopropanamine |
|---|---|
| PubChem CID | 81174282 |
| Molecular Formula | C13H14N2S |
| Molecular Weight | 230.34 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | N-[(4-phenyl-1,3-thiazol-5-yl)methyl]cyclopropanamine |
| SMILES | c1ccc(-c2ncsc2CNC2CC2)cc1 |
| InChI | InChI=1S/C13H14N2S/c1-2-4-10(5-3-1)13-12(16-9-15-13)8-14-11-6-7-11/h1-5,9,11,14H,6-8H2 |
| InChIKey | MKJLFQIDQYKSDU-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.34 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |