C11H10ClN3OS — CID 65211720
[5-(4-chlorophenyl)-1,3-oxazol-2-yl]methyl carbamimidothioate (PubChem CID 65211720) has the molecular formula C11H10ClN3OS and a molecular weight of 267.74 g/mol. Its IUPAC name is [5-(4-chlorophenyl)-1,3-oxazol-2-yl]methyl carbamimidothioate.
| Compound Name | [5-(4-chlorophenyl)-1,3-oxazol-2-yl]methyl carbamimidothioate |
|---|---|
| PubChem CID | 65211720 |
| Molecular Formula | C11H10ClN3OS |
| Molecular Weight | 267.74 g/mol |
| Exact Mass | 267.02 |
| IUPAC Name | [5-(4-chlorophenyl)-1,3-oxazol-2-yl]methyl carbamimidothioate |
| SMILES | [H]/N=C(\N)SCc1ncc(-c2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C11H10ClN3OS/c12-8-3-1-7(2-4-8)9-5-15-10(16-9)6-17-11(13)14/h1-5H,6H2,(H3,13,14) |
| InChIKey | HQKAQDFQTBYVFU-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 75.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.74 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|