About 7-oxa-11λ6-thia-15-azadispiro[5.1.58.36]hexadecane 11,11-dioxide
7-oxa-11λ6-thia-15-azadispiro[5.1.58.36]hexadecane 11,11-dioxide (PubChem CID 65213486) has the molecular formula C13H23NO3S
and a molecular weight of 273.40 g/mol. Its IUPAC name is 7-oxa-11λ6-thia-15-azadispiro[5.1.58.36]hexadecane 11,11-dioxide.
Molecular Properties
| Compound Name | 7-oxa-11λ6-thia-15-azadispiro[5.1.58.36]hexadecane 11,11-dioxide |
| PubChem CID | 65213486 |
| Molecular Formula | C13H23NO3S |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | 7-oxa-11λ6-thia-15-azadispiro[5.1.58.36]hexadecane 11,11-dioxide |
| SMILES | O=S1(=O)CCC2(CC1)CNCC1(CCCCC1)O2 |
| InChI | InChI=1S/C13H23NO3S/c15-18(16)8-6-13(7-9-18)11-14-10-12(17-13)4-2-1-3-5-12/h14H,1-11H2 |
| InChIKey | ORVCQMOPGLRPGT-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-oxa-11λ6-thia-15-azadispiro[5.1.58.36]hexadecane 11,11-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-oxa-11λ6-thia-15-azadispiro[5.1.58.36]hexadecane 11,11-dioxide?
The IUPAC name of 7-oxa-11λ6-thia-15-azadispiro[5.1.58.36]hexadecane 11,11-dioxide (CID 65213486) is 7-oxa-11λ6-thia-15-azadispiro[5.1.58.36]hexadecane 11,11-dioxide.
What is the SMILES notation for 7-oxa-11λ6-thia-15-azadispiro[5.1.58.36]hexadecane 11,11-dioxide?
The canonical SMILES for 7-oxa-11λ6-thia-15-azadispiro[5.1.58.36]hexadecane 11,11-dioxide is O=S1(=O)CCC2(CC1)CNCC1(CCCCC1)O2.
What is the InChIKey of 7-oxa-11λ6-thia-15-azadispiro[5.1.58.36]hexadecane 11,11-dioxide?
The InChIKey is ORVCQMOPGLRPGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23NO3S/c15-18(16)8-6-13(7-9-18)11-14-10-12(17-13)4-2-1-3-5-12/h14H,1-11H2.
What are the key properties of 7-oxa-11λ6-thia-15-azadispiro[5.1.58.36]hexadecane 11,11-dioxide?
7-oxa-11λ6-thia-15-azadispiro[5.1.58.36]hexadecane 11,11-dioxide has a molecular weight of 273.40 g/mol, XLogP of 1.26, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-oxa-11λ6-thia-15-azadispiro[5.1.58.36]hexadecane 11,11-dioxide is sourced from PubChem (CID 65213486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).