About 10,10-dioxo-1-oxa-10λ6-thia-3-azaspiro[5.6]dodecan-2-one
10,10-dioxo-1-oxa-10λ6-thia-3-azaspiro[5.6]dodecan-2-one (PubChem CID 84796178) has the molecular formula C9H15NO4S
and a molecular weight of 233.29 g/mol. Its IUPAC name is 10,10-dioxo-1-oxa-10λ6-thia-3-azaspiro[5.6]dodecan-2-one.
Molecular Properties
| Compound Name | 10,10-dioxo-1-oxa-10λ6-thia-3-azaspiro[5.6]dodecan-2-one |
| PubChem CID | 84796178 |
| Molecular Formula | C9H15NO4S |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 10,10-dioxo-1-oxa-10λ6-thia-3-azaspiro[5.6]dodecan-2-one |
| SMILES | O=C1NCCC2(CCCS(=O)(=O)CC2)O1 |
| InChI | InChI=1S/C9H15NO4S/c11-8-10-5-3-9(14-8)2-1-6-15(12,13)7-4-9/h1-7H2,(H,10,11) |
| InChIKey | OTVVXDQMKFNCTB-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 10,10-dioxo-1-oxa-10λ6-thia-3-azaspiro[5.6]dodecan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10,10-dioxo-1-oxa-10λ6-thia-3-azaspiro[5.6]dodecan-2-one?
The IUPAC name of 10,10-dioxo-1-oxa-10λ6-thia-3-azaspiro[5.6]dodecan-2-one (CID 84796178) is 10,10-dioxo-1-oxa-10λ6-thia-3-azaspiro[5.6]dodecan-2-one.
What is the SMILES notation for 10,10-dioxo-1-oxa-10λ6-thia-3-azaspiro[5.6]dodecan-2-one?
The canonical SMILES for 10,10-dioxo-1-oxa-10λ6-thia-3-azaspiro[5.6]dodecan-2-one is O=C1NCCC2(CCCS(=O)(=O)CC2)O1.
What is the InChIKey of 10,10-dioxo-1-oxa-10λ6-thia-3-azaspiro[5.6]dodecan-2-one?
The InChIKey is OTVVXDQMKFNCTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO4S/c11-8-10-5-3-9(14-8)2-1-6-15(12,13)7-4-9/h1-7H2,(H,10,11).
What are the key properties of 10,10-dioxo-1-oxa-10λ6-thia-3-azaspiro[5.6]dodecan-2-one?
10,10-dioxo-1-oxa-10λ6-thia-3-azaspiro[5.6]dodecan-2-one has a molecular weight of 233.29 g/mol, XLogP of 0.45, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 10,10-dioxo-1-oxa-10λ6-thia-3-azaspiro[5.6]dodecan-2-one is sourced from PubChem (CID 84796178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).