C14H18N2O2 — CID 165471452
2-benzyl-6-oxa-2,8-diazaspiro[4.5]decan-7-one (PubChem CID 165471452) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 2-benzyl-6-oxa-2,8-diazaspiro[4.5]decan-7-one.
| Compound Name | 2-benzyl-6-oxa-2,8-diazaspiro[4.5]decan-7-one |
|---|---|
| PubChem CID | 165471452 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 2-benzyl-6-oxa-2,8-diazaspiro[4.5]decan-7-one |
| SMILES | O=C1NCCC2(CCN(Cc3ccccc3)C2)O1 |
| InChI | InChI=1S/C14H18N2O2/c17-13-15-8-6-14(18-13)7-9-16(11-14)10-12-4-2-1-3-5-12/h1-5H,6-11H2,(H,15,17) |
| InChIKey | FLCXKOLDQLTHSW-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |