C7H13N3O2 — CID 105434734
1-oxa-3,4,9-triazaspiro[5.5]undecan-2-one (PubChem CID 105434734) has the molecular formula C7H13N3O2 and a molecular weight of 171.20 g/mol. Its IUPAC name is 1-oxa-3,4,9-triazaspiro[5.5]undecan-2-one.
| Compound Name | 1-oxa-3,4,9-triazaspiro[5.5]undecan-2-one |
|---|---|
| PubChem CID | 105434734 |
| Molecular Formula | C7H13N3O2 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | 1-oxa-3,4,9-triazaspiro[5.5]undecan-2-one |
| SMILES | O=C1NNCC2(CCNCC2)O1 |
| InChI | InChI=1S/C7H13N3O2/c11-6-10-9-5-7(12-6)1-3-8-4-2-7/h8-9H,1-5H2,(H,10,11) |
| InChIKey | PFYVLPGMFNJBOO-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |