C10H16N2O2 — CID 154006136
4-cyclopropyl-1-oxa-3,8-diazaspiro[4.5]decan-2-one (PubChem CID 154006136) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is 4-cyclopropyl-1-oxa-3,8-diazaspiro[4.5]decan-2-one.
| Compound Name | 4-cyclopropyl-1-oxa-3,8-diazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 154006136 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 4-cyclopropyl-1-oxa-3,8-diazaspiro[4.5]decan-2-one |
| SMILES | O=C1NC(C2CC2)C2(CCNCC2)O1 |
| InChI | InChI=1S/C10H16N2O2/c13-9-12-8(7-1-2-7)10(14-9)3-5-11-6-4-10/h7-8,11H,1-6H2,(H,12,13) |
| InChIKey | PXZJOQKFQJRFJM-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |