C14H16ClNO2 — CID 68753647
5-chloro-3-methylspiro[3H-chromene-2,4'-piperidine]-4-one (PubChem CID 68753647) has the molecular formula C14H16ClNO2 and a molecular weight of 265.74 g/mol. Its IUPAC name is 5-chloro-3-methylspiro[3H-chromene-2,4'-piperidine]-4-one.
| Compound Name | 5-chloro-3-methylspiro[3H-chromene-2,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 68753647 |
| Molecular Formula | C14H16ClNO2 |
| Molecular Weight | 265.74 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 5-chloro-3-methylspiro[3H-chromene-2,4'-piperidine]-4-one |
| SMILES | CC1C(=O)c2c(Cl)cccc2OC12CCNCC2 |
| InChI | InChI=1S/C14H16ClNO2/c1-9-13(17)12-10(15)3-2-4-11(12)18-14(9)5-7-16-8-6-14/h2-4,9,16H,5-8H2,1H3 |
| InChIKey | HEJFGXXICZKSQN-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.74 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |