C16H13ClO3 — CID 102434881
5-(2-chlorophenyl)-2,2-dimethyl-1,3-benzodioxin-4-one (PubChem CID 102434881) has the molecular formula C16H13ClO3 and a molecular weight of 288.73 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-2,2-dimethyl-1,3-benzodioxin-4-one.
| Compound Name | 5-(2-chlorophenyl)-2,2-dimethyl-1,3-benzodioxin-4-one |
|---|---|
| PubChem CID | 102434881 |
| Molecular Formula | C16H13ClO3 |
| Molecular Weight | 288.73 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 5-(2-chlorophenyl)-2,2-dimethyl-1,3-benzodioxin-4-one |
| SMILES | CC1(C)OC(=O)c2c(cccc2-c2ccccc2Cl)O1 |
| InChI | InChI=1S/C16H13ClO3/c1-16(2)19-13-9-5-7-11(14(13)15(18)20-16)10-6-3-4-8-12(10)17/h3-9H,1-2H3 |
| InChIKey | CVNRAYBOSGZMLL-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.73 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |