C10H9ClO4 — CID 71535773
6-chloro-7-hydroxy-2,2-dimethyl-1,3-benzodioxin-4-one (PubChem CID 71535773) has the molecular formula C10H9ClO4 and a molecular weight of 228.63 g/mol. Its IUPAC name is 6-chloro-7-hydroxy-2,2-dimethyl-1,3-benzodioxin-4-one.
| Compound Name | 6-chloro-7-hydroxy-2,2-dimethyl-1,3-benzodioxin-4-one |
|---|---|
| PubChem CID | 71535773 |
| Molecular Formula | C10H9ClO4 |
| Molecular Weight | 228.63 g/mol |
| Exact Mass | 228.02 |
| IUPAC Name | 6-chloro-7-hydroxy-2,2-dimethyl-1,3-benzodioxin-4-one |
| SMILES | CC1(C)OC(=O)c2cc(Cl)c(O)cc2O1 |
| InChI | InChI=1S/C10H9ClO4/c1-10(2)14-8-4-7(12)6(11)3-5(8)9(13)15-10/h3-4,12H,1-2H3 |
| InChIKey | UXRKEBBQOABWOV-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.63 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |