C12H13ClN2O2 — CID 117103622
5-chlorospiro[1H-3,1-benzoxazine-4,4'-piperidine]-2-one (PubChem CID 117103622) has the molecular formula C12H13ClN2O2 and a molecular weight of 252.70 g/mol. Its IUPAC name is 5-chlorospiro[1H-3,1-benzoxazine-4,4'-piperidine]-2-one.
| Compound Name | 5-chlorospiro[1H-3,1-benzoxazine-4,4'-piperidine]-2-one |
|---|---|
| PubChem CID | 117103622 |
| Molecular Formula | C12H13ClN2O2 |
| Molecular Weight | 252.70 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 5-chlorospiro[1H-3,1-benzoxazine-4,4'-piperidine]-2-one |
| SMILES | O=C1Nc2cccc(Cl)c2C2(CCNCC2)O1 |
| InChI | InChI=1S/C12H13ClN2O2/c13-8-2-1-3-9-10(8)12(17-11(16)15-9)4-6-14-7-5-12/h1-3,14H,4-7H2,(H,15,16) |
| InChIKey | JTUXELXAXPZWHT-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.70 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |