About 4-methylidene-1,3-dioxa-8-azaspiro[4.5]decan-2-one
4-methylidene-1,3-dioxa-8-azaspiro[4.5]decan-2-one (PubChem CID 19814300) has the molecular formula C8H11NO3
and a molecular weight of 169.18 g/mol. Its IUPAC name is 4-methylidene-1,3-dioxa-8-azaspiro[4.5]decan-2-one.
Analyze 4-methylidene-1,3-dioxa-8-azaspiro[4.5]decan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylidene-1,3-dioxa-8-azaspiro[4.5]decan-2-one?
The IUPAC name of 4-methylidene-1,3-dioxa-8-azaspiro[4.5]decan-2-one (CID 19814300) is 4-methylidene-1,3-dioxa-8-azaspiro[4.5]decan-2-one.
What is the SMILES notation for 4-methylidene-1,3-dioxa-8-azaspiro[4.5]decan-2-one?
The canonical SMILES for 4-methylidene-1,3-dioxa-8-azaspiro[4.5]decan-2-one is C=C1OC(=O)OC12CCNCC2.
What is the InChIKey of 4-methylidene-1,3-dioxa-8-azaspiro[4.5]decan-2-one?
The InChIKey is WLCCCNSINMDGSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO3/c1-6-8(12-7(10)11-6)2-4-9-5-3-8/h9H,1-5H2.
What are the key properties of 4-methylidene-1,3-dioxa-8-azaspiro[4.5]decan-2-one?
4-methylidene-1,3-dioxa-8-azaspiro[4.5]decan-2-one has a molecular weight of 169.18 g/mol, XLogP of 0.79, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylidene-1,3-dioxa-8-azaspiro[4.5]decan-2-one is sourced from PubChem (CID 19814300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).