C8H13N3O2 — CID 143147204
2-methylimino-1-oxa-3,8-diazaspiro[4.5]decan-4-one (PubChem CID 143147204) has the molecular formula C8H13N3O2 and a molecular weight of 183.21 g/mol. Its IUPAC name is 2-methylimino-1-oxa-3,8-diazaspiro[4.5]decan-4-one.
| Compound Name | 2-methylimino-1-oxa-3,8-diazaspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 143147204 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | 2-methylimino-1-oxa-3,8-diazaspiro[4.5]decan-4-one |
| SMILES | C/N=C1/NC(=O)C2(CCNCC2)O1 |
| InChI | InChI=1S/C8H13N3O2/c1-9-7-11-6(12)8(13-7)2-4-10-5-3-8/h10H,2-5H2,1H3,(H,9,11,12) |
| InChIKey | ZDIUGVYEMUIENL-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|