C8H12N2O2 — CID 170380628
6,7-dimethyl-5-oxa-2,8-diazaspiro[3.5]non-6-en-9-one (PubChem CID 170380628) has the molecular formula C8H12N2O2 and a molecular weight of 168.20 g/mol. Its IUPAC name is 6,7-dimethyl-5-oxa-2,8-diazaspiro[3.5]non-6-en-9-one.
| Compound Name | 6,7-dimethyl-5-oxa-2,8-diazaspiro[3.5]non-6-en-9-one |
|---|---|
| PubChem CID | 170380628 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | 6,7-dimethyl-5-oxa-2,8-diazaspiro[3.5]non-6-en-9-one |
| SMILES | CC1=C(C)OC2(CNC2)C(=O)N1 |
| InChI | InChI=1S/C8H12N2O2/c1-5-6(2)12-8(3-9-4-8)7(11)10-5/h9H,3-4H2,1-2H3,(H,10,11) |
| InChIKey | QWOCVEKHDVUSAP-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |