C9H15NO2 — CID 126983039
3,3-dimethyl-4-(oxolan-3-yl)azetidin-2-one (PubChem CID 126983039) has the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. Its IUPAC name is 3,3-dimethyl-4-(oxolan-3-yl)azetidin-2-one.
| Compound Name | 3,3-dimethyl-4-(oxolan-3-yl)azetidin-2-one |
|---|---|
| PubChem CID | 126983039 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | 3,3-dimethyl-4-(oxolan-3-yl)azetidin-2-one |
| SMILES | CC1(C)C(=O)NC1C1CCOC1 |
| InChI | InChI=1S/C9H15NO2/c1-9(2)7(10-8(9)11)6-3-4-12-5-6/h6-7H,3-5H2,1-2H3,(H,10,11) |
| InChIKey | DBHHUVIBAYYWLV-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |