C8H13NO — CID 98602184
(4S)-4-cyclopropyl-3,3-dimethylazetidin-2-one (PubChem CID 98602184) has the molecular formula C8H13NO and a molecular weight of 139.20 g/mol. Its IUPAC name is (4S)-4-cyclopropyl-3,3-dimethylazetidin-2-one.
| Compound Name | (4S)-4-cyclopropyl-3,3-dimethylazetidin-2-one |
|---|---|
| PubChem CID | 98602184 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | (4S)-4-cyclopropyl-3,3-dimethylazetidin-2-one |
| SMILES | CC1(C)C(=O)N[C@H]1C1CC1 |
| InChI | InChI=1S/C8H13NO/c1-8(2)6(5-3-4-5)9-7(8)10/h5-6H,3-4H2,1-2H3,(H,9,10)/t6-/m0/s1 |
| InChIKey | YAUJPRYRAHUFLA-LURJTMIESA-N |
| XLogP | 0.92 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |