C7H10N2O2 — CID 154147627
1-oxa-3,8-diazaspiro[4.5]dec-2-en-4-one (PubChem CID 154147627) has the molecular formula C7H10N2O2 and a molecular weight of 154.17 g/mol. Its IUPAC name is 1-oxa-3,8-diazaspiro[4.5]dec-2-en-4-one.
| Compound Name | 1-oxa-3,8-diazaspiro[4.5]dec-2-en-4-one |
|---|---|
| PubChem CID | 154147627 |
| Molecular Formula | C7H10N2O2 |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.07 |
| IUPAC Name | 1-oxa-3,8-diazaspiro[4.5]dec-2-en-4-one |
| SMILES | O=C1N=COC12CCNCC2 |
| InChI | InChI=1S/C7H10N2O2/c10-6-7(11-5-9-6)1-3-8-4-2-7/h5,8H,1-4H2 |
| InChIKey | LRNBSYITVSXOBW-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |