C16H24O3 — CID 65213913
1-[[2-[(1R)-1-hydroxyethyl]-4-methylphenoxy]methyl]cyclohexan-1-ol (PubChem CID 65213913) has the molecular formula C16H24O3 and a molecular weight of 264.37 g/mol. Its IUPAC name is 1-[[2-[(1R)-1-hydroxyethyl]-4-methylphenoxy]methyl]cyclohexan-1-ol.
| Compound Name | 1-[[2-[(1R)-1-hydroxyethyl]-4-methylphenoxy]methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 65213913 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 1-[[2-[(1R)-1-hydroxyethyl]-4-methylphenoxy]methyl]cyclohexan-1-ol |
| SMILES | Cc1ccc(OCC2(O)CCCCC2)c([C@@H](C)O)c1 |
| InChI | InChI=1S/C16H24O3/c1-12-6-7-15(14(10-12)13(2)17)19-11-16(18)8-4-3-5-9-16/h6-7,10,13,17-18H,3-5,8-9,11H2,1-2H3/t13-/m1/s1 |
| InChIKey | CLWJVFOFBBSOLH-CYBMUJFWSA-N |
| XLogP | 3.12 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |