C16H24O4 — CID 82001257
1-[[2-[(1S)-1-hydroxyethyl]-5-methoxyphenoxy]methyl]cyclohexan-1-ol (PubChem CID 82001257) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is 1-[[2-[(1S)-1-hydroxyethyl]-5-methoxyphenoxy]methyl]cyclohexan-1-ol.
| Compound Name | 1-[[2-[(1S)-1-hydroxyethyl]-5-methoxyphenoxy]methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 82001257 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 1-[[2-[(1S)-1-hydroxyethyl]-5-methoxyphenoxy]methyl]cyclohexan-1-ol |
| SMILES | COc1ccc([C@H](C)O)c(OCC2(O)CCCCC2)c1 |
| InChI | InChI=1S/C16H24O4/c1-12(17)14-7-6-13(19-2)10-15(14)20-11-16(18)8-4-3-5-9-16/h6-7,10,12,17-18H,3-5,8-9,11H2,1-2H3/t12-/m0/s1 |
| InChIKey | VYHMJQRGZBTPHQ-LBPRGKRZSA-N |
| XLogP | 2.82 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |