C8H12N4OS — CID 65214276
1,4-diazepan-1-yl(thiadiazol-4-yl)methanone (PubChem CID 65214276) has the molecular formula C8H12N4OS and a molecular weight of 212.28 g/mol. Its IUPAC name is 1,4-diazepan-1-yl(thiadiazol-4-yl)methanone.
| Compound Name | 1,4-diazepan-1-yl(thiadiazol-4-yl)methanone |
|---|---|
| PubChem CID | 65214276 |
| Molecular Formula | C8H12N4OS |
| Molecular Weight | 212.28 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | 1,4-diazepan-1-yl(thiadiazol-4-yl)methanone |
| SMILES | O=C(c1csnn1)N1CCCNCC1 |
| InChI | InChI=1S/C8H12N4OS/c13-8(7-6-14-11-10-7)12-4-1-2-9-3-5-12/h6,9H,1-5H2 |
| InChIKey | DIKBDUWSIGMQSD-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.28 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |