About 1-[5-(thiadiazol-4-yl)-1,3,4-oxadiazol-2-yl]ethanamine
1-[5-(thiadiazol-4-yl)-1,3,4-oxadiazol-2-yl]ethanamine (PubChem CID 65215754) has the molecular formula C6H7N5OS
and a molecular weight of 197.22 g/mol. Its IUPAC name is 1-[5-(thiadiazol-4-yl)-1,3,4-oxadiazol-2-yl]ethanamine.
Analyze 1-[5-(thiadiazol-4-yl)-1,3,4-oxadiazol-2-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(thiadiazol-4-yl)-1,3,4-oxadiazol-2-yl]ethanamine?
The IUPAC name of 1-[5-(thiadiazol-4-yl)-1,3,4-oxadiazol-2-yl]ethanamine (CID 65215754) is 1-[5-(thiadiazol-4-yl)-1,3,4-oxadiazol-2-yl]ethanamine.
What is the SMILES notation for 1-[5-(thiadiazol-4-yl)-1,3,4-oxadiazol-2-yl]ethanamine?
The canonical SMILES for 1-[5-(thiadiazol-4-yl)-1,3,4-oxadiazol-2-yl]ethanamine is CC(N)c1nnc(-c2csnn2)o1.
What is the InChIKey of 1-[5-(thiadiazol-4-yl)-1,3,4-oxadiazol-2-yl]ethanamine?
The InChIKey is IHNMINAYRGWBRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N5OS/c1-3(7)5-9-10-6(12-5)4-2-13-11-8-4/h2-3H,7H2,1H3.
What are the key properties of 1-[5-(thiadiazol-4-yl)-1,3,4-oxadiazol-2-yl]ethanamine?
1-[5-(thiadiazol-4-yl)-1,3,4-oxadiazol-2-yl]ethanamine has a molecular weight of 197.22 g/mol, XLogP of 0.61, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(thiadiazol-4-yl)-1,3,4-oxadiazol-2-yl]ethanamine is sourced from PubChem (CID 65215754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).