C8H11N5OS — CID 65215815
N-methyl-3-[5-(thiadiazol-4-yl)-1,3,4-oxadiazol-2-yl]propan-1-amine (PubChem CID 65215815) has the molecular formula C8H11N5OS and a molecular weight of 225.28 g/mol. Its IUPAC name is N-methyl-3-[5-(thiadiazol-4-yl)-1,3,4-oxadiazol-2-yl]propan-1-amine.
| Compound Name | N-methyl-3-[5-(thiadiazol-4-yl)-1,3,4-oxadiazol-2-yl]propan-1-amine |
|---|---|
| PubChem CID | 65215815 |
| Molecular Formula | C8H11N5OS |
| Molecular Weight | 225.28 g/mol |
| Exact Mass | 225.07 |
| IUPAC Name | N-methyl-3-[5-(thiadiazol-4-yl)-1,3,4-oxadiazol-2-yl]propan-1-amine |
| SMILES | CNCCCc1nnc(-c2csnn2)o1 |
| InChI | InChI=1S/C8H11N5OS/c1-9-4-2-3-7-11-12-8(14-7)6-5-15-13-10-6/h5,9H,2-4H2,1H3 |
| InChIKey | FNYDFZLKJQVGDB-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 76.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.28 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|