C16H13NO2S — CID 6521989
(2Z)-2-[(4-methoxyphenyl)methylidene]-4H-1,4-benzothiazin-3-one (PubChem CID 6521989) has the molecular formula C16H13NO2S and a molecular weight of 283.35 g/mol. Its IUPAC name is (2Z)-2-[(4-methoxyphenyl)methylidene]-4H-1,4-benzothiazin-3-one.
| Compound Name | (2Z)-2-[(4-methoxyphenyl)methylidene]-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 6521989 |
| Molecular Formula | C16H13NO2S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | (2Z)-2-[(4-methoxyphenyl)methylidene]-4H-1,4-benzothiazin-3-one |
| SMILES | COc1ccc(/C=C2\Sc3ccccc3NC2=O)cc1 |
| InChI | InChI=1S/C16H13NO2S/c1-19-12-8-6-11(7-9-12)10-15-16(18)17-13-4-2-3-5-14(13)20-15/h2-10H,1H3,(H,17,18)/b15-10- |
| InChIKey | WKPXOGZQKUEJFF-GDNBJRDFSA-N |
| XLogP | 3.78 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|