C14H28N2O4 — CID 65221138
2-[[[butan-2-yl(2-methoxyethyl)carbamoyl]amino]methyl]pentanoic acid (PubChem CID 65221138) has the molecular formula C14H28N2O4 and a molecular weight of 288.39 g/mol. Its IUPAC name is 2-[[[butan-2-yl(2-methoxyethyl)carbamoyl]amino]methyl]pentanoic acid.
| Compound Name | 2-[[[butan-2-yl(2-methoxyethyl)carbamoyl]amino]methyl]pentanoic acid |
|---|---|
| PubChem CID | 65221138 |
| Molecular Formula | C14H28N2O4 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | 2-[[[butan-2-yl(2-methoxyethyl)carbamoyl]amino]methyl]pentanoic acid |
| SMILES | CCCC(CNC(=O)N(CCOC)C(C)CC)C(=O)O |
| InChI | InChI=1S/C14H28N2O4/c1-5-7-12(13(17)18)10-15-14(19)16(8-9-20-4)11(3)6-2/h11-12H,5-10H2,1-4H3,(H,15,19)(H,17,18) |
| InChIKey | YEIGEKXRIHYJJO-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |