C11H24N2O — CID 65228049
2-ethyl-N'-methyl-N'-(oxan-4-yl)propane-1,3-diamine (PubChem CID 65228049) has the molecular formula C11H24N2O and a molecular weight of 200.33 g/mol. Its IUPAC name is 2-ethyl-N'-methyl-N'-(oxan-4-yl)propane-1,3-diamine.
| Compound Name | 2-ethyl-N'-methyl-N'-(oxan-4-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 65228049 |
| Molecular Formula | C11H24N2O |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.19 |
| IUPAC Name | 2-ethyl-N'-methyl-N'-(oxan-4-yl)propane-1,3-diamine |
| SMILES | CCC(CN)CN(C)C1CCOCC1 |
| InChI | InChI=1S/C11H24N2O/c1-3-10(8-12)9-13(2)11-4-6-14-7-5-11/h10-11H,3-9,12H2,1-2H3 |
| InChIKey | KOFKATOXYHAKSW-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |