C12H15FN2O3 — CID 65228530
4-[2-(aminomethyl)butanoylamino]-3-fluorobenzoic acid (PubChem CID 65228530) has the molecular formula C12H15FN2O3 and a molecular weight of 254.26 g/mol. Its IUPAC name is 4-[2-(aminomethyl)butanoylamino]-3-fluorobenzoic acid.
| Compound Name | 4-[2-(aminomethyl)butanoylamino]-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 65228530 |
| Molecular Formula | C12H15FN2O3 |
| Molecular Weight | 254.26 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 4-[2-(aminomethyl)butanoylamino]-3-fluorobenzoic acid |
| SMILES | CCC(CN)C(=O)Nc1ccc(C(=O)O)cc1F |
| InChI | InChI=1S/C12H15FN2O3/c1-2-7(6-14)11(16)15-10-4-3-8(12(17)18)5-9(10)13/h3-5,7H,2,6,14H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | XURJDXSLYVSDDC-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.26 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |