C10H16N4O3 — CID 65231536
ethyl 2-[2-(1H-imidazol-5-yl)ethylcarbamoylamino]acetate (PubChem CID 65231536) has the molecular formula C10H16N4O3 and a molecular weight of 240.26 g/mol. Its IUPAC name is ethyl 2-[2-(1H-imidazol-5-yl)ethylcarbamoylamino]acetate.
| Compound Name | ethyl 2-[2-(1H-imidazol-5-yl)ethylcarbamoylamino]acetate |
|---|---|
| PubChem CID | 65231536 |
| Molecular Formula | C10H16N4O3 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | ethyl 2-[2-(1H-imidazol-5-yl)ethylcarbamoylamino]acetate |
| SMILES | CCOC(=O)CNC(=O)NCCc1cnc[nH]1 |
| InChI | InChI=1S/C10H16N4O3/c1-2-17-9(15)6-13-10(16)12-4-3-8-5-11-7-14-8/h5,7H,2-4,6H2,1H3,(H,11,14)(H2,12,13,16) |
| InChIKey | RUYFQJADEGQNHW-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |