C13H19N5O2 — CID 65232235
ethyl 5-amino-2-ethyl-1-[2-(1H-imidazol-5-yl)ethyl]imidazole-4-carboxylate (PubChem CID 65232235) has the molecular formula C13H19N5O2 and a molecular weight of 277.33 g/mol. Its IUPAC name is ethyl 5-amino-2-ethyl-1-[2-(1H-imidazol-5-yl)ethyl]imidazole-4-carboxylate.
| Compound Name | ethyl 5-amino-2-ethyl-1-[2-(1H-imidazol-5-yl)ethyl]imidazole-4-carboxylate |
|---|---|
| PubChem CID | 65232235 |
| Molecular Formula | C13H19N5O2 |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | ethyl 5-amino-2-ethyl-1-[2-(1H-imidazol-5-yl)ethyl]imidazole-4-carboxylate |
| SMILES | CCOC(=O)c1nc(CC)n(CCc2cnc[nH]2)c1N |
| InChI | InChI=1S/C13H19N5O2/c1-3-10-17-11(13(19)20-4-2)12(14)18(10)6-5-9-7-15-8-16-9/h7-8H,3-6,14H2,1-2H3,(H,15,16) |
| InChIKey | HUOQMADHKWGXQC-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |