C12H21N3O3 — CID 102700414
ethyl 5-amino-2-ethyl-1-(2-methoxypropyl)imidazole-4-carboxylate (PubChem CID 102700414) has the molecular formula C12H21N3O3 and a molecular weight of 255.32 g/mol. Its IUPAC name is ethyl 5-amino-2-ethyl-1-(2-methoxypropyl)imidazole-4-carboxylate.
| Compound Name | ethyl 5-amino-2-ethyl-1-(2-methoxypropyl)imidazole-4-carboxylate |
|---|---|
| PubChem CID | 102700414 |
| Molecular Formula | C12H21N3O3 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | ethyl 5-amino-2-ethyl-1-(2-methoxypropyl)imidazole-4-carboxylate |
| SMILES | CCOC(=O)c1nc(CC)n(CC(C)OC)c1N |
| InChI | InChI=1S/C12H21N3O3/c1-5-9-14-10(12(16)18-6-2)11(13)15(9)7-8(3)17-4/h8H,5-7,13H2,1-4H3 |
| InChIKey | YSDOELLXTNCMLX-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |