C12H16F3N3O2 — CID 106211501
ethyl 5-amino-2-ethyl-1-[1-(trifluoromethyl)cyclopropyl]imidazole-4-carboxylate (PubChem CID 106211501) has the molecular formula C12H16F3N3O2 and a molecular weight of 291.27 g/mol. Its IUPAC name is ethyl 5-amino-2-ethyl-1-[1-(trifluoromethyl)cyclopropyl]imidazole-4-carboxylate.
| Compound Name | ethyl 5-amino-2-ethyl-1-[1-(trifluoromethyl)cyclopropyl]imidazole-4-carboxylate |
|---|---|
| PubChem CID | 106211501 |
| Molecular Formula | C12H16F3N3O2 |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | ethyl 5-amino-2-ethyl-1-[1-(trifluoromethyl)cyclopropyl]imidazole-4-carboxylate |
| SMILES | CCOC(=O)c1nc(CC)n(C2(C(F)(F)F)CC2)c1N |
| InChI | InChI=1S/C12H16F3N3O2/c1-3-7-17-8(10(19)20-4-2)9(16)18(7)11(5-6-11)12(13,14)15/h3-6,16H2,1-2H3 |
| InChIKey | JIYGPMFELZMQQT-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |