C9H17N3 — CID 65232249
N-[2-(1H-imidazol-5-yl)ethyl]butan-2-amine (PubChem CID 65232249) has the molecular formula C9H17N3 and a molecular weight of 167.26 g/mol. Its IUPAC name is N-[2-(1H-imidazol-5-yl)ethyl]butan-2-amine.
| Compound Name | N-[2-(1H-imidazol-5-yl)ethyl]butan-2-amine |
|---|---|
| PubChem CID | 65232249 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | N-[2-(1H-imidazol-5-yl)ethyl]butan-2-amine |
| SMILES | CCC(C)NCCc1cnc[nH]1 |
| InChI | InChI=1S/C9H17N3/c1-3-8(2)11-5-4-9-6-10-7-12-9/h6-8,11H,3-5H2,1-2H3,(H,10,12) |
| InChIKey | DGPWUAQBMVRSGM-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |